CymitQuimica logo

CAS 98027-21-5

:

2-Aminothiazole-4-carbonitrile

Description:
2-Aminothiazole-4-carbonitrile is a heterocyclic organic compound characterized by the presence of both an amino group and a carbonitrile group attached to a thiazole ring. The thiazole moiety contributes to its aromatic properties and potential reactivity, while the amino group can participate in hydrogen bonding and nucleophilic reactions. The carbonitrile group introduces a polar functional group, enhancing the compound's solubility in polar solvents and influencing its chemical behavior. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure makes it of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. Additionally, 2-Aminothiazole-4-carbonitrile can serve as a building block in the synthesis of more complex molecules, making it valuable in pharmaceutical research and development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H3N3S
InChI:InChI=1S/C4H3N3S/c5-1-3-2-8-4(6)7-3/h2H,(H2,6,7)
InChI key:YWADAVLEEDKKHR-UHFFFAOYSA-N
SMILES:C1=C(N=C(S1)N)C#N
Synonyms:
  • 2-Amino-4-thiazolecarbonitrile
  • 2-aminothiazole-4-carbonitrile
  • 4-Thiazolecarbonitrile, 2-amino
  • 2-Amino-4-cyanothiazole
  • 2-AMinothiazole-4-ca
  • 4-Thiazolecarbonitrile,2-amino-(6CI,9CI)
Found 4 products.