CymitQuimica logo

CAS 98027-52-2

:

1-Acetyl-4-iodo-1H-pyrazole

Description:
1-Acetyl-4-iodo-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an acetyl group (-COCH3) at the 1-position and an iodine atom at the 4-position of the pyrazole ring, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as ethanol and dichloromethane. The presence of the iodine atom can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the acetyl group can participate in further chemical transformations, making this compound a valuable intermediate in organic synthesis. Its applications may extend to pharmaceuticals and agrochemicals, where pyrazole derivatives are often explored for their biological activities. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C5H5IN2O
InChI:InChI=1/C5H5IN2O/c1-4(9)8-3-5(6)2-7-8/h2-3H,1H3
InChI key:VQBDZJOQOOMNRZ-UHFFFAOYSA-N
SMILES:CC(=O)n1cc(cn1)I
Synonyms:
  • 1-(4-Iod-1H-pyrazol-1-yl)ethanon
  • 1-(4-Iodo-1H-pyrazol-1-yl)ethanone
  • ethanone, 1-(4-iodo-1H-pyrazol-1-yl)-
Found 4 products.