CymitQuimica logo

CAS 98036-00-1

:

1,3,5-tris-[3,5-(dicarboxy)phenoxymethyl]benzene

Description:
1,3,5-Tris-[3,5-(dicarboxy)phenoxymethyl]benzene, with the CAS number 98036-00-1, is a complex organic compound characterized by its multi-functional structure. This substance features a central benzene ring substituted with three phenoxymethyl groups, each of which is further substituted with dicarboxylic acid moieties. The presence of these carboxylic acid groups imparts significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. The compound is likely to exhibit properties such as high thermal stability and potential applications in polymer chemistry, particularly in the synthesis of cross-linked networks or as a building block for advanced materials. Its structural complexity suggests that it may also have applications in fields such as drug delivery or as a ligand in coordination chemistry. Additionally, the presence of multiple functional groups allows for further chemical modifications, making it a versatile compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C33H24O15
InChI:InChI=1S/C33H24O15/c34-28(35)19-4-20(29(36)37)8-25(7-19)46-13-16-1-17(14-47-26-9-21(30(38)39)5-22(10-26)31(40)41)3-18(2-16)15-48-27-11-23(32(42)43)6-24(12-27)33(44)45/h1-12H,13-15H2,(H,34,35)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)
InChI key:SOMOSKNBLUQRSL-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1COC2=CC(=CC(=C2)C(=O)O)C(=O)O)COC3=CC(=CC(=C3)C(=O)O)C(=O)O)COC4=CC(=CC(=C4)C(=O)O)C(=O)O
Synonyms:
  • 1,3,5-tris-[3,5-(dicarboxy)phenoxymethyl]benzene
  • 1,3-Benzenedicarboxylic acid, 5,5',5''-[1,3,5-benzenetriyltris(methyleneoxy)]tris-
Found 2 products.