CymitQuimica logo

CAS 98041-67-9

:

2,5-Dibromophenyl isothiocyanate

Description:
2,5-Dibromophenyl isothiocyanate is an organic compound characterized by the presence of both bromine atoms and an isothiocyanate functional group. It features a phenyl ring substituted at the 2 and 5 positions with bromine atoms, which enhances its reactivity and potential applications in various chemical reactions. The isothiocyanate group (-N=C=S) is known for its ability to participate in nucleophilic reactions, making this compound useful in synthetic organic chemistry, particularly in the development of agrochemicals and pharmaceuticals. It is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. The compound is also known for its potential as a reagent in the synthesis of other chemical entities, including thioureas and other derivatives. As with many halogenated compounds, it may pose environmental concerns, and its use should be managed in accordance with safety regulations. Overall, 2,5-Dibromophenyl isothiocyanate is a versatile compound with significant implications in chemical research and industry.
Formula:C7H3Br2NS
InChI:InChI=1/C7H3Br2NS/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H
InChI key:JYMRVQQSUHKIST-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)N=C=S)Br
Synonyms:
  • 1,4-Dibromo-2-Isothiocyanatobenzene
Found 4 products.