CymitQuimica logo

CAS 98079-83-5

:

3-Quinolinecarboxylic acid,1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-, ethylester

Description:
3-Quinolinecarboxylic acid, 1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-, ethyl ester, identified by CAS number 98079-83-5, is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system. This compound features multiple functional groups, including an ethyl ester and a piperazine moiety, contributing to its potential biological activity. The presence of difluoro substituents enhances its lipophilicity and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The piperazine ring is often associated with various pharmacological effects, making this compound a candidate for further research in areas such as antimicrobial or antitumor activity. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used, which are crucial for its application in biological systems or as a lead compound in drug discovery.
Formula:C19H23F2N3O3
InChI:InChI=1S/C19H23F2N3O3/c1-4-23-10-13(19(26)27-5-2)18(25)12-8-14(20)17(15(21)16(12)23)24-7-6-22-11(3)9-24/h8,10-11,22H,4-7,9H2,1-3H3
InChI key:LNNAIKLYSCYPOG-UHFFFAOYSA-N
SMILES:CCN1C=C(C(=O)C2=CC(=C(C(=C21)F)N3CCNC(C3)C)F)C(=O)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.