CymitQuimica logo

CAS 98083-43-3

:

1H-Indazole, 1-acetyl-5-chloro-

Description:
1H-Indazole, 1-acetyl-5-chloro- is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an acetyl group at the 1-position and a chlorine atom at the 5-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. It may participate in various chemical reactions, including electrophilic substitutions due to the electron-rich indazole ring. The chlorine substituent can also influence its reactivity, potentially allowing for further functionalization. 1H-Indazole derivatives are of interest in medicinal chemistry, as they may exhibit biological activity, including anti-inflammatory and anticancer properties. The compound's molecular structure and substituents can significantly affect its pharmacological profile, making it a subject of research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c1-6(13)12-9-3-2-8(10)4-7(9)5-11-12/h2-5H,1H3
InChI key:LNRWUGNNZNFPPR-UHFFFAOYSA-N
SMILES:CC(=O)N1C2=C(C=C(C=C2)Cl)C=N1
Found 4 products.