CAS 98094-87-2
:Lupinalbin A
Description:
Lupinalbin A, with the CAS number 98094-87-2, is a natural product belonging to the class of alkaloids. It is primarily derived from certain plant species, particularly those in the genus Lupinus. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Lupinalbin A has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antitumor activities. Its mechanism of action is thought to involve interactions with various biological targets, although specific pathways may vary. Additionally, the compound's solubility, stability, and reactivity can be influenced by environmental factors and the presence of other substances. Research into Lupinalbin A continues to explore its therapeutic potential and the underlying mechanisms that govern its effects, making it a subject of interest in both natural product chemistry and drug development.
Formula:C15H8O6
InChI:InChI=1S/C15H8O6/c16-6-1-2-8-10(4-6)20-15-12(8)14(19)13-9(18)3-7(17)5-11(13)21-15/h1-5,16-18H
InChI key:InChIKey=BBBAWACESCACAP-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(OC2OC=4C1=C(O)C=C(O)C4)=CC(O)=CC3
Synonyms:- 1,3,8-Trihydroxy-11H-benzofuro[2,3-b][1]benzopyran-11-one
- 11H-benzofuro[2,3-b][1]benzopyran-11-one, 1,3,8-trihydroxy-
- Boeravinone L
- Lupinalbin A
- 1,3,8-Trihydroxy-11H-[1]benzofuro[2,3-b]chromen-11-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Lupinalbin A
CAS:Lupinalbin A: potent ERα/aryl hydrocarbon agonist, anti-inflammatory via cytokine inhibition, blocks IFN-β/STAT1 in Eriosema laurentii.Formula:C15H8O6Color and Shape:SolidMolecular weight:284.22Lupinalbin A
CAS:Lupinalbin A is a natural compound, which is a type of phenolic compound, sourced from white lupin (Lupinus albus) seeds. This compound exhibits significant biological activity primarily through its ability to modulate cellular signaling pathways. Its mode of action includes the inhibition of specific kinases and transcription factors, which are crucial in the progression of inflammatory and cancerous processes.Formula:C15H8O6Purity:Min. 95%Color and Shape:PowderMolecular weight:284.22 g/mol

