CymitQuimica logo

CAS 98121-41-6

:

5-Amino-2,3-dichloropyridine

Description:
5-Amino-2,3-dichloropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two chlorine atoms at the 2 and 3 positions of the pyridine ring, along with an amino group at the 5 position, contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar organic solvents. It is often used in the synthesis of various pharmaceuticals and agrochemicals due to its reactivity and ability to participate in further chemical transformations. The amino group can act as a nucleophile, while the chlorine atoms can serve as leaving groups in substitution reactions. Additionally, 5-amino-2,3-dichloropyridine may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Proper handling and disposal procedures are essential when working with this substance.
Formula:C5H4Cl2N2
InChI:InChI=1S/C5H4Cl2N2/c6-4-1-3(8)2-9-5(4)7/h1-2H,8H2
InChI key:XTCHZNJJTQACES-UHFFFAOYSA-N
SMILES:C1=C(C=NC(=C1Cl)Cl)N
Synonyms:
  • 5,6-Dichloropyridin-3-Amine
Found 6 products.