CymitQuimica logo

CAS 98135-75-2

:

Cyclobutanol, 1-ethynyl-

Description:
Cyclobutanol, 1-ethynyl- is an organic compound characterized by the presence of a cyclobutane ring and an ethynyl group. Its molecular structure features a four-membered carbon ring (cyclobutane) with a hydroxyl (-OH) group and an ethynyl group (-C≡CH) attached to it. This compound is typically a colorless liquid or solid, depending on the temperature and purity. Cyclobutanol derivatives are known for their potential applications in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its polarity, influencing its solubility in various solvents. Additionally, the ethynyl group can participate in various chemical reactions, such as nucleophilic additions and cycloadditions, making it a versatile building block in synthetic chemistry. Due to its unique structure, cyclobutanol, 1-ethynyl- may exhibit interesting physical and chemical properties, including reactivity and stability under different conditions. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C6H8O
InChI:InChI=1S/C6H8O/c1-2-6(7)4-3-5-6/h1,7H,3-5H2
InChI key:MXZYOPVAKCCOJN-UHFFFAOYSA-N
SMILES:C#CC1(CCC1)O
Found 4 products.