CymitQuimica logo

CAS 98137-96-3

:

1,3-dibromo-2-iodo-5-nitrobenzene

Description:
1,3-Dibromo-2-iodo-5-nitrobenzene is an aromatic compound characterized by the presence of multiple halogen substituents and a nitro group on a benzene ring. This compound features two bromine atoms at the 1 and 3 positions, an iodine atom at the 2 position, and a nitro group at the 5 position of the benzene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of these electronegative substituents influences the compound's electronic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The nitro group, being a strong electron-withdrawing group, enhances the electrophilicity of the aromatic ring, facilitating further chemical transformations. Additionally, the compound's physical properties, such as solubility and melting point, are influenced by the bulky halogen atoms and the nitro group. Due to its structural complexity, 1,3-dibromo-2-iodo-5-nitrobenzene may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry.
Formula:C6H2Br2INO2
InChI:InChI=1/C6H2Br2INO2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H
InChI key:ZTLNIHDUCWPSGZ-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1Br)I)Br)[N+](=O)[O-]
Found 2 products.