CymitQuimica logo

CAS 98138-05-7

:

2,4-Dichloropteridine

Description:
2,4-Dichloropteridine is a heterocyclic organic compound characterized by its pteridine structure, which includes a fused bicyclic system containing nitrogen atoms. This compound features two chlorine substituents at the 2 and 4 positions of the pteridine ring, which significantly influence its chemical reactivity and properties. Typically, compounds like 2,4-Dichloropteridine exhibit moderate to high solubility in polar organic solvents due to the presence of electronegative chlorine atoms, which can engage in dipole interactions. The presence of chlorine also enhances the compound's potential for electrophilic substitution reactions. Additionally, 2,4-Dichloropteridine may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability under various conditions, along with its reactivity, can be influenced by the electronic effects of the chlorine substituents. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C6H2Cl2N4
InChI:InChI=1/C6H2Cl2N4/c7-4-3-5(10-2-1-9-3)12-6(8)11-4/h1-2H
InChI key:WVSQXWZADZZUSV-UHFFFAOYSA-N
SMILES:c1cnc2c(c(Cl)nc(Cl)n2)n1
Synonyms:
  • Pteridine, 2,4-Dichloro-
Found 4 products.