CymitQuimica logo

CAS 98139-15-2

:

4-aminopyridine-2-carbonitrile

Description:
4-Aminopyridine-2-carbonitrile is an organic compound characterized by its pyridine ring, which is substituted with an amino group and a cyano group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological disorders. The presence of the amino group contributes to its basicity, while the cyano group enhances its reactivity, making it a versatile intermediate in organic synthesis. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and biological activity. Additionally, 4-aminopyridine-2-carbonitrile may exhibit properties such as moderate stability under standard conditions, but it should be handled with care due to potential toxicity associated with its derivatives. Overall, this compound serves as an important building block in the synthesis of more complex molecules and has garnered interest for its pharmacological properties.
Formula:C6H5N3
InChI:InChI=1/C6H5N3/c7-4-6-3-5(8)1-2-9-6/h1-3H,(H2,8,9)
InChI key:GMKRESMCPMIWGU-UHFFFAOYSA-N
SMILES:c1cnc(cc1N)C#N
Synonyms:
  • 2-Pyridinecarbonitrile, 4-Amino-
  • 4-Aminopicolinonitrile
  • 4-Amino-2-cyanopyridine
Found 4 products.