CAS 98139-72-1
:(3-methylbutyl)boronic acid
Description:
(3-Methylbutyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a branched alkyl chain. Its molecular structure features a boron atom bonded to a hydroxyl group and an alkyl group, specifically a 3-methylbutyl group, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents and exhibits moderate stability under standard conditions. (3-Methylbutyl)boronic acid is of significant interest in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a key reagent for the formation of carbon-carbon bonds. Additionally, it can act as a ligand in coordination chemistry and is utilized in the development of boron-containing materials. Its reactivity is influenced by the presence of the boronic acid group, allowing for various transformations in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as with many organoboron compounds, due to potential toxicity and reactivity.
Formula:C5H13BO2
InChI:InChI=1/C5H13BO2/c1-5(2)3-4-6(7)8/h5,7-8H,3-4H2,1-2H3
SMILES:CC(C)CCB(O)O
Synonyms:- Isopentylboronic Acid
- 3-Methyl-1-butylboronia acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(3-Methylbutyl)boronic acid
CAS:(3-Methylbutyl)boronic acidFormula:C5H13BO2Purity:97%Color and Shape: white solidMolecular weight:115.97g/mol3-Methylbutylboronic acid extrapure, 95%
CAS:Formula:C5H13BO2Purity:min. 95%Color and Shape:White to Off white, Crystalline compoundMolecular weight:116.00Isopentylboronic acid
CAS:<p>Isopentylboronic acid is a boron-containing organic compound that is used for the catalysis of cross-coupling reactions, such as the Suzuki reaction. It reacts with aryl halides to form an alkylboronic ester and a metal salt. Isopentylboronic acid is also used to produce trimers in the presence of formyl or nitro groups. Isopentylboronic acid may also be used as a reagent to convert alcohols into chlorides or bromides. This compound has been shown to react with alkali metal ions on one side and alkyl substituents on the other side, leading to deuterium incorporation at the carbon atom adjacent to the carboxylic acid group. Isopentylboronic acid can also be used for dehydrating alcohols and converting alkynes into alkenes when heated in the presence of an alkali metal chloride.</p>Formula:C5H13BO2Purity:Min. 95%Molecular weight:115.97 g/mol




