CymitQuimica logo

CAS 98139-72-1

:

(3-methylbutyl)boronic acid

Description:
(3-Methylbutyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a branched alkyl chain. Its molecular structure features a boron atom bonded to a hydroxyl group and an alkyl group, specifically a 3-methylbutyl group, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents and exhibits moderate stability under standard conditions. (3-Methylbutyl)boronic acid is of significant interest in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a key reagent for the formation of carbon-carbon bonds. Additionally, it can act as a ligand in coordination chemistry and is utilized in the development of boron-containing materials. Its reactivity is influenced by the presence of the boronic acid group, allowing for various transformations in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as with many organoboron compounds, due to potential toxicity and reactivity.
Formula:C5H13BO2
InChI:InChI=1/C5H13BO2/c1-5(2)3-4-6(7)8/h5,7-8H,3-4H2,1-2H3
InChI key:UVMWVBMFEDQYRW-UHFFFAOYSA-N
SMILES:CC(C)CCB(O)O
Synonyms:
  • Isopentylboronic Acid
  • 3-Methyl-1-butylboronia acid
Found 6 products.