CymitQuimica logo

CAS 98140-73-9

:

3-isoxazol-5-ylpropanoic acid

Description:
3-Isoxazol-5-ylpropanoic acid is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a propanoic acid moiety, contributing to its acidic properties. The isoxazole ring is known for its stability and is often involved in various biological activities, making derivatives of this compound of interest in medicinal chemistry. The presence of the propanoic acid group suggests that it can participate in acid-base reactions, and its structure may influence its solubility and reactivity in different solvents. Additionally, the compound may exhibit specific interactions with biological targets, potentially acting as a ligand or modulator in biochemical pathways. Its CAS number, 98140-73-9, allows for easy identification in chemical databases and literature. Overall, 3-isoxazol-5-ylpropanoic acid is a compound of interest for research in organic synthesis and pharmacology due to its unique structural features and potential applications.
Formula:C6H7NO3
InChI:InChI=1/C6H7NO3/c8-6(9)2-1-5-3-4-7-10-5/h3-4H,1-2H2,(H,8,9)
InChI key:YFYBODHSQLOQOF-UHFFFAOYSA-N
SMILES:C(CC(=O)O)c1ccno1
Synonyms:
  • 5-Isoxazolepropanoic Acid
Found 2 products.