CAS 98190-98-8
:2-Pentyl-1-indanone
Description:
2-Pentyl-1-indanone, with the CAS number 98190-98-8, is an organic compound characterized by its unique structure, which combines a pentyl chain with an indanone moiety. This compound typically appears as a colorless to pale yellow liquid and possesses a distinctive aromatic odor. It is classified as a ketone due to the presence of a carbonyl group (C=O) adjacent to the indanone structure. The compound is known for its moderate volatility and solubility in organic solvents, making it useful in various applications, including fragrance and flavor industries. Additionally, 2-pentyl-1-indanone may exhibit biological activity, although specific studies on its pharmacological properties are limited. As with many organic compounds, it is essential to handle 2-pentyl-1-indanone with care, adhering to safety guidelines to avoid potential health hazards associated with exposure. Overall, its unique structural features and properties make it a compound of interest in both industrial and research settings.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)14(12)15/h5-7,9,12H,2-4,8,10H2,1H3
InChI key:GRIYYYHMDLLGBC-UHFFFAOYSA-N
SMILES:CCCCCC1CC2=CC=CC=C2C1=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
