CAS 98191-30-1
:3,5-dichloro-4-fluorobenzoic acid
Description:
3,5-Dichloro-4-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms and one fluorine atom attached to a benzene ring, along with a carboxylic acid functional group (-COOH). This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of halogen substituents can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The compound may exhibit biological activity, and its derivatives can be explored for various applications in medicinal chemistry. Safety data indicates that, like many halogenated compounds, it should be handled with care, as it may pose environmental and health risks. Proper storage conditions and handling protocols are essential to mitigate any potential hazards associated with this chemical.
Formula:C7H3Cl2FO2
InChI:InChI=1/C7H3Cl2FO2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)
SMILES:c1c(cc(c(c1Cl)F)Cl)C(=O)O
Synonyms:- Benzoic Acid, 3,5-Dichloro-4-Fluoro-
- Qvr Cg Eg Df [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dichloro-4-fluorobenzoic acid
CAS:Formula:C7H3Cl2FO2Purity:98%Color and Shape:SolidMolecular weight:209.00193,5-Dichloro-4-fluorobenzoic acid
CAS:Formula:C7H3Cl2FO2Purity:95.0%Color and Shape:SolidMolecular weight:2093,5-Dichloro-4-fluorobenzoic acid
CAS:3,5-Dichloro-4-fluorobenzoic acidFormula:C7H3Cl2FO2Purity:98%Color and Shape:White Solid-PowderMolecular weight:209.001923,5-Dichloro-4-fluorobenzoic acid
CAS:3,5-Dichloro-4-fluorobenzoic acid is a chemical that belongs to the class of reagents. It reacts with an amine to form a urea and a dioxane derivative. 3,5-Dichloro-4-fluorobenzoic acid is used in the research and development of new drugs as a useful scaffold for novel compounds. It can be used as an intermediate or building block in the synthesis of complex molecules. This chemical also has speciality uses as a fine chemical, such as for use in cosmetics or cleaning products.Formula:C7H3Cl2FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:209 g/mol




