CymitQuimica logo

CAS 98198-25-5

:

9H-Purine-6-carboxylic acid, hydrazide

Description:
9H-Purine-6-carboxylic acid, hydrazide, identified by its CAS number 98198-25-5, is a chemical compound that belongs to the class of purine derivatives. This substance features a purine ring structure, which is a fundamental component of nucleic acids, and is characterized by the presence of a carboxylic acid group and a hydrazide functional group. The compound is typically a white to off-white solid and is soluble in polar solvents, which is common for many hydrazides. Its chemical properties may include the ability to form hydrogen bonds due to the presence of both the carboxylic acid and hydrazide functionalities, potentially influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and biochemistry, due to its structural similarity to nucleobases and potential biological activities. However, specific applications and biological effects would require further investigation and research.
Formula:C6H6N6O
InChI:InChI=1S/C6H6N6O/c7-12-6(13)4-3-5(10-1-8-3)11-2-9-4/h1-2H,7H2,(H,12,13)(H,8,9,10,11)
InChI key:InChIKey=RGYOBLPIWGOBMK-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C2C(=NC=N1)N=CN2
Synonyms:
  • Purine-6-carboxylic acid, hydrazide
  • 9H-Purine-6-carboxylic acid, hydrazide
Found 1 products.