CymitQuimica logo

CAS 98203-04-4

:

6-bromo-5-nitroquinoline

Description:
6-Bromo-5-nitroquinoline is a heterocyclic organic compound characterized by the presence of a quinoline ring system, which consists of a fused benzene and pyridine structure. The compound features a bromine atom at the 6-position and a nitro group at the 5-position of the quinoline ring, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, and its molecular structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic attacks. The presence of the bromine and nitro groups can enhance its reactivity and influence its solubility in different solvents. This compound is of interest in medicinal chemistry and materials science due to its potential biological activities and applications in the synthesis of other complex molecules. Additionally, its properties may be influenced by factors such as pH, temperature, and the presence of other chemical species in the environment. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C9H5BrN2O2
InChI:InChI=1S/C9H5BrN2O2/c10-7-3-4-8-6(2-1-5-11-8)9(7)12(13)14/h1-5H
InChI key:ISBMTVQQECNRQY-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CC(=C2[N+](=O)[O-])Br)N=C1
Found 4 products.