
CAS 98206-09-8
:1-(2,3-Dihydro-1,4-benzodioxin-5-yl)piperazine hydrochloride
Description:
1-(2,3-Dihydro-1,4-benzodioxin-5-yl)piperazine hydrochloride is a chemical compound characterized by its unique structure, which includes a piperazine ring and a benzodioxin moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the piperazine group suggests potential pharmacological activity, as piperazine derivatives are often explored for their effects on the central nervous system and other biological targets. The hydrochloride salt form enhances its stability and solubility, which is beneficial for formulation in pharmaceutical contexts. Its molecular structure may contribute to specific interactions with biological receptors, potentially influencing its efficacy and safety profile. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and drug development.
Formula:C12H16N2O2
InChI:InChI=1/C12H16N2O2/c1-2-10(14-6-4-13-5-7-14)12-11(3-1)15-8-9-16-12/h1-3,13H,4-9H2
SMILES:c1cc(c2c(c1)OCCO2)N1CCNCC1
Synonyms:- Eltoprazine Hydrochloride
- Du-28853
- 1-(2,3-Dihydro-1,4-Benzodioxin-5-Yl)Piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Eltoprazine hydrochloride
CAS:Eltoprazine hydrochloride (DU 28853 hydrochloride) is a partial agonist at serotonin 5-HT1A, 5-HT1B, and 5-HT2B receptors (Ki value of 40, 52, and 81 nM,Formula:C12H17ClN2O2Purity:99.35%Color and Shape:SolidMolecular weight:256.73Eltoprazine hydrochloride
CAS:Controlled ProductEltoprazine hydrochloride is a 5-HT agonist that is used to treat chronic oral, locomotor activity disorders. It stimulates the release of dopamine and inhibits the reuptake of serotonin and norepinephrine. Eltoprazine hydrochloride binds to 5-HT1A receptors at higher doses, but has little affinity for 5-HT2 receptors. The drug also binds to gamma-aminobutyric acid (GABA) receptors, which may contribute to its effects on locomotion. Eltoprazine hydrochloride also has shown an ability to bind to the 5-HT1 receptor in vitro and has been shown to inhibit locomotor activity in CD-1 mice.Formula:C12H17ClN2O2Purity:Min. 95%Color and Shape:White To Yellow SolidMolecular weight:256.73 g/mol

