CAS 98244-48-5
:S(+)-3-bromo-2-methyl-1-propanol
Description:
S(+)-3-bromo-2-methyl-1-propanol is an organic compound characterized by its chiral center, which contributes to its specific optical activity. As a bromo alcohol, it contains a bromine atom and a hydroxyl group (-OH) attached to a three-carbon chain, making it a primary alcohol. The presence of the bromine atom enhances its reactivity, allowing it to participate in various nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in water due to the polar nature of the hydroxyl group, and it may also dissolve in organic solvents. The chirality of S(+)-3-bromo-2-methyl-1-propanol is significant in applications such as pharmaceuticals and agrochemicals, where the specific enantiomer can exhibit different biological activities. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, S(+)-3-bromo-2-methyl-1-propanol is a versatile compound with important implications in synthetic organic chemistry.
Formula:C4H9BrO
InChI:InChI=1/C4H9BrO/c1-4(2-5)3-6/h4,6H,2-3H2,1H3/t4-/m1/s1
SMILES:C[C@H](CBr)CO
Synonyms:- (2S)-3-bromo-2-methylpropan-1-ol
- (S)-(+)-3-Bromo-2-methyl-1-propanol
- (2S)-3-Bromo-2-methyl-1-propanol
- 3-Bromo-2-Methyl-1-Propanol
- 3-Bromo-2-methyl-1-propanolS-form
- (S)-3-broMo-2-Methylpropan-1-ol
- (S)-3-BROMO-2-METHYL-PROPANOL
- (S)-(+)-3-BroMo-2-Methyl-1-propanol 97%
- 1-Propanol, 3-bromo-2-methyl-, (2S)-
- (2S)-3-Bromo-2-methyl-propan-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-3-Bromo-2-methylpropan-1-ol
CAS:(S)-3-Bromo-2-methylpropan-1-olFormula:C4H9BrOPurity:98%Molecular weight:153.02(S)-3-Bromo-2-methylpropan-1-ol
CAS:Formula:C4H9BrOPurity:98%Color and Shape:LiquidMolecular weight:153.0177(2S)-3-Bromo-2-methyl-1-propanol
CAS:(2S)-3-Bromo-2-methyl-1-propanol is a versatile compound that has various applications in research and chemical synthesis. It is commonly used as an intermediate in the production of catechols, which are important building blocks in organic synthesis. This compound exhibits polymorphic properties, meaning it can exist in different crystal structures. Additionally, (2S)-3-Bromo-2-methyl-1-propanol is phosphorescent, making it useful in the development of luminescent materials.
Formula:C4H9BrOPurity:Min. 95%Molecular weight:153.02 g/mol



