CymitQuimica logo

CAS 98272-33-4

:

2-Propenoic acid, 3-cyclopropyl-, methyl ester

Description:
2-Propenoic acid, 3-cyclopropyl-, methyl ester, commonly known as methyl 3-cyclopropylacrylate, is an organic compound characterized by its acrylate structure, which includes a vinyl group and an ester functional group. This compound features a cyclopropyl group attached to the third carbon of the acrylate chain, contributing to its unique reactivity and physical properties. It is typically a colorless to pale yellow liquid with a characteristic odor. Methyl 3-cyclopropylacrylate is known for its ability to undergo polymerization, making it useful in the production of various polymers and copolymers. Its reactivity is influenced by the presence of the double bond in the acrylate moiety, allowing it to participate in addition reactions. Additionally, this compound may exhibit moderate volatility and solubility in organic solvents, while being less soluble in water. Safety considerations include potential irritant effects, necessitating proper handling and storage practices. Overall, methyl 3-cyclopropylacrylate is a valuable compound in synthetic organic chemistry and materials science.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c1-9-7(8)5-4-6-2-3-6/h4-6H,2-3H2,1H3/b5-4+
InChI key:IPOOZKZLEDMDSB-SNAWJCMRSA-N
SMILES:COC(=O)/C=C/C1CC1
Synonyms:
  • Methyl 3-cyclopropylacrylate
Found 3 products.