CymitQuimica logo

CAS 98273-47-3

:

2-Cyano-4-pyridinecarboxamide

Description:
2-Cyano-4-pyridinecarboxamide, with the CAS number 98273-47-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-CN) and a carboxamide group (-C(=O)NH2) attached to the pyridine ring, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide functional group. The cyano group enhances its ability to participate in nucleophilic reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Cyano-4-pyridinecarboxamide is of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features and functional groups.
Formula:C7H5N3O
InChI:InChI=1S/C7H5N3O/c8-4-6-3-5(7(9)11)1-2-10-6/h1-3H,(H2,9,11)
InChI key:VGJSESNRQXAFHQ-UHFFFAOYSA-N
SMILES:C1=CN=C(C=C1C(=O)N)C#N
Synonyms:
  • 2-Cyanoisonicotinamide
Found 4 products.