CAS 98276-75-6
:4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxylic acid
Description:
4-Methyl-2-(methylsulfanyl)pyrimidine-5-carboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group at the 5-position, contributing to its acidity and potential reactivity. The presence of a methylsulfanyl group at the 2-position introduces a sulfur atom, which can influence the compound's chemical properties, such as solubility and reactivity. The methyl group at the 4-position adds to the overall hydrophobic character of the molecule. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for various interactions in biological systems, potentially leading to applications in medicinal chemistry. As with many pyrimidine derivatives, it may participate in hydrogen bonding and other intermolecular interactions, affecting its behavior in different environments. Overall, 4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C7H8N2O2S
InChI:InChI=1/C7H8N2O2S/c1-4-5(6(10)11)3-8-7(9-4)12-2/h3H,1-2H3,(H,10,11)
SMILES:Cc1c(cnc(n1)SC)C(=O)O
Synonyms:- 4-methyl-2-(methylthio)pyrimidine-5-carboxylic acid
- 4-methyl-2-methylsulfanylpyrimidine-5-carboxylic acid
- 4-Methyl-2-(methylthio)-5-pyrimidinecarboxylic Acid
- 5-Pyrimidinecarboxylicacid, 4-methyl-2-(methylthio)-
- 4-Methyl-2-(methylsulphanyl)pyrimidine-5-carboxylic acid, 5-Carboxy-4-methyl-2-(methylthio)pyrimidine, 5-Carboxy-4-methyl-2-(methylsulphanyl)pyrimidine
- 4-Methyl-2-(methylthio)pyrimidine-5-carboxylic acid ,97%
- 4-Methyl-2-(methylsulphanyl)pyrimidine-5-carboxylic acid
- 4-METHYL-2-(METHYLTHIO)PYRIMIDINE-5-CARBOXYLIC ACID ISO 9001:2015 REACH
- 4-methyl-2-methylsulfanylpyrimidine-5-carboxylicaci
- 4-Methyl-2-(methylsulfanyl)-5-pyrimidinecarboxylic acid≥ 98.5% (HPLC)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methyl-2-(methylthio)pyrimidine-5-carboxylic acid
CAS:4-Methyl-2-(methylthio)pyrimidine-5-carboxylic acidFormula:C7H8N2O2SPurity:95%Color and Shape:SolidMolecular weight:184.215625-Pyrimidinecarboxylicacid, 4-methyl-2-(methylthio)-
CAS:Formula:C7H8N2O2SPurity:95%Color and Shape:SolidMolecular weight:184.21564-Methyl-2-(methylsulfanyl)-5-pyrimidinecarboxylic acid
CAS:Formula:C7H8N2O2SPurity:95%Molecular weight:184.214-Methyl-2-(methylsulfanyl)-5-pyrimidinecarboxylic acid
CAS:Ribonucleosides, deoxyribonucleosides, and their activated forms (e.g., 4-methyl-2-(methylsulfanyl)-5-pyrimidinecarboxylic acid) are all important intermediates for the synthesis of DNA and RNA. Ribonucleosides are the key building blocks for the synthesis of DNA. They can be converted to nucleosides by removal of the ribose moiety. Deoxyribonucleosides are synthesized from ribonucleosides by removal of the hydroxyl group from carbon 2' position of ribose. The activated forms (e.g., 4-methyl-2-(methylsulfanyl)-5-pyrimidinecarboxylic acid) are useful in phosphoramidite chemistry as they have a free amine group on one side and a free sulfonyl group on the other side that can be used to react with a growing oligo or polyphosph
Formula:C7H8N2O2SPurity:Min. 95%Molecular weight:184.22 g/mol



