CymitQuimica logo

CAS 98278-78-5

:

3-bromo-5H,7H-furo[3,4-b]pyridine-5,7-dione

Description:
3-bromo-5H,7H-furo[3,4-b]pyridine-5,7-dione is a heterocyclic compound characterized by its fused furan and pyridine rings, which contribute to its unique chemical properties. The presence of bromine at the 3-position enhances its reactivity and potential for substitution reactions. This compound features two carbonyl groups (diones) at the 5 and 7 positions, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The furo[3,4-b]pyridine structure imparts specific electronic properties, making it of interest in medicinal chemistry and materials science. Its potential applications may include use as a building block in organic synthesis or as a precursor for more complex molecules. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine atom and the dione functional groups. Overall, 3-bromo-5H,7H-furo[3,4-b]pyridine-5,7-dione is a versatile compound with significant implications in various chemical research fields.
Formula:C7H2BrNO3
InChI:InChI=1S/C7H2BrNO3/c8-3-1-4-5(9-2-3)7(11)12-6(4)10/h1-2H
InChI key:FMIBWNJUQJRTER-UHFFFAOYSA-N
SMILES:C1=C(C=NC2=C1C(=O)OC2=O)Br
Found 5 products.