CAS 98288-12-1

Formula: C9H9BrO4S

InChI: InChI=1S/C9H9BrO4S/c10-8-3-1-2-7(4-8)5-15(13,14)6-9(11)12/h1-4H,5-6H2,(H,11,12)

InChI key: XFGDBXMRFDVKNI-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)Br)CS(=O)(=O)CC(=O)O

2-[(3-bromophenyl)methanesulfonyl]acetic acid

CAS: 98288-12-1

2-[(3-bromophenyl)methanesulfonyl]acetic acid

Formula: C₉H₉BrO₄S

Purity: 95%

Molecular weight: 291.94

Ref: 54-OR1176334

2-[(3-Bromophenyl)methanesulfonyl]acetic acid

CAS: 98288-12-1

2-[(3-Bromophenyl)methanesulfonyl]acetic acid is a white crystalline solid that inhibits ion channels by binding to the ligand-binding site of the channel protein. It is a research tool that can be used to study ion channel proteins and their interactions with other proteins, such as antibodies and peptides. 2-[(3-Bromophenyl)methanesulfonyl]acetic acid has been shown to inhibit ligand-gated ion channels, including nicotinic acetylcholine receptors and GABAA receptors. This inhibitor also binds to voltage-gated ion channels, inhibiting sodium and potassium currents.

Formula: C₉H₉BrO₄S

Purity: Min. 95%

Molecular weight: 293.14 g/mol

Ref: 3D-YDA28812