CymitQuimica logo

CAS 98298-49-8

:

Benzonitrile,4-(1H-imidazol-2-yl)-

Description:
Benzonitrile, 4-(1H-imidazol-2-yl)-, also known by its CAS number 98298-49-8, is an organic compound characterized by the presence of a benzonitrile moiety substituted with an imidazole ring. This compound features a nitrile functional group (-C≡N) attached to a benzene ring, which contributes to its aromatic properties. The imidazole ring, a five-membered heterocyclic structure containing two nitrogen atoms, imparts unique chemical reactivity and potential biological activity. Benzonitrile derivatives are often utilized in various chemical syntheses and can serve as intermediates in the production of pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents and relatively low polarity make it suitable for applications in organic synthesis and as a solvent in various chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H7N3
InChI:InChI=1S/C10H7N3/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10/h1-6H,(H,12,13)
InChI key:ISJCKCQDMBPKML-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C#N)C2=NC=CN2
Synonyms:
  • 4-(1H-Imidazol-2-Yl)-Benzonitrile
Found 4 products.