CAS 98320-39-9

Acetic acid,2-(10-methoxy-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)-

Description:

Acetic acid, 2-(10-methoxy-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)-, identified by CAS number 98320-39-9, is a chemical compound that features a unique structure combining acetic acid with a complex bicyclic thienobenzene moiety. This compound is characterized by its functional groups, including a carboxylic acid (-COOH) and a methoxy group (-OCH3), which contribute to its reactivity and solubility properties. The presence of the thienobenzene structure suggests potential applications in organic electronics or as a building block in organic synthesis due to its aromatic characteristics. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility in polar solvents, such as water and alcohols, is influenced by the carboxylic acid group, while the aromatic system may enhance its stability and interaction with other molecules. Overall, this compound represents a fascinating intersection of organic chemistry and potential applications in various fields.

Formula: C₁₆H₁₂O₃S

InChI: InChI=1S/C16H12O3S/c1-19-14-8-10-4-2-3-5-11(10)13(9-15(17)18)12-6-7-20-16(12)14/h2-9H,1H3,(H,17,18)/b13-9-

InChI key: XIKRQPKFOKKGGW-LCYFTJDESA-N

SMILES: COC1=CC2=CC=CC=C2/C(=C/C(=O)O)/C3=C1SC=C3

Synonyms:

• Ix 207-887
• Aceticacid, (10-methoxy-4H-benzo[4,5]cyclohepta[1,2-b]thien-4-ylidene)- (9CI)

IX 207-887

CAS: 98320-39-9

IX 207-887

Formula: C₁₆H₁₂O₃S

Purity: 98.96%

Molecular weight: 284.33

Ref: 54-OR1135713

IX 207-887

CAS: 98320-39-9

Formula: C₁₆H₁₂O₃S

Purity: 98.96%

Molecular weight: 284.3297

Ref: IN-DA000Y3Q

IX 207-887

CAS: 98320-39-9

IX 207-887 inhibits the release of interleukin-1 (IL-1). IX 207-887 is a novel antiarthritic agent.

Formula: C₁₆H₁₂O₃S

Color and Shape: Solid

Molecular weight: 284.33

Ref: TM-T11697

(2Z)-2-(8-Methoxy-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene)acetic acid

CAS: 98320-39-9

(2Z)-2-(8-Methoxy-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene)acetic acid is a synthetic small molecule, designed as a specialized compound for targeting specific biochemical pathways. It is derived through precision chemical synthesis, ensuring high purity and efficacy. The compound acts by modulating certain receptor activities, altering signal transduction mechanisms at a cellular level. This modulation may influence various biological processes, making it a candidate for research in therapeutic applications.

Formula: C₁₆H₁₂O₃S

Purity: Min. 95%

Molecular weight: 284.3 g/mol

Ref: 3D-YDA32039