CymitQuimica logo

CAS 98330-15-5

:

L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-, 1,1-dimethylethyl ester

Description:
L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-, 1,1-dimethylethyl ester, with CAS number 98330-15-5, is a derivative of the amino acid L-cysteine, which is known for its role in protein synthesis and as a precursor to the antioxidant glutathione. This compound features a protective group, specifically a tert-butoxycarbonyl (Boc) group, which is commonly used in peptide synthesis to protect the amino group from unwanted reactions. The presence of the tert-butyl ester indicates that it is likely to be more lipophilic, enhancing its solubility in organic solvents. L-Cysteine itself contains a thiol (-SH) group, which contributes to its reactivity and ability to form disulfide bonds, crucial for protein structure. The compound may be utilized in various biochemical applications, including peptide synthesis and as a building block in drug development. Its stability and reactivity can be influenced by the presence of the Boc group, making it a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C12H23NO4S
InChI:InChI=1S/C12H23NO4S/c1-11(2,3)16-9(14)8(7-18)13-10(15)17-12(4,5)6/h8,18H,7H2,1-6H3,(H,13,15)/t8-/m0/s1
InChI key:ZLVFXLRGWYCEIQ-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)[C@H](CS)NC(=O)OC(C)(C)C
Found 4 products.