CAS 98377-35-6
:1-(2-Chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one
Description:
1-(2-Chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one is a chemical compound characterized by its tetrazole ring structure, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features a chlorophenyl group, indicating the presence of a chlorine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The presence of the dihydro group suggests that the compound may exist in a reduced form, potentially affecting its stability and interactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the chlorine substituent can enhance lipophilicity, potentially influencing its bioavailability and interaction with biological targets. As with many nitrogen-containing heterocycles, it may also exhibit interesting properties such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects.
Formula:C7H5ClN4O
InChI:InChI=1S/C7H5ClN4O/c8-5-3-1-2-4-6(5)12-7(13)9-10-11-12/h1-4H,(H,9,11,13)
InChI key:InChIKey=NTLCSWYRVIMNEI-UHFFFAOYSA-N
SMILES:O=C1N(N=NN1)C2=C(Cl)C=CC=C2
Synonyms:- 1-(2-Chloro-phenyl)-1,2-dihydro-tetrazol-5-one
- 1-(2-Chloro-phenyl)-1,4-dihydro-5H-tetrazol-5-one
- 1-(2-Chlorophenyl)-1H-tetrazol-5(4H)-one
- 1-(2-Chlorophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one
- 1-(2-Chlorophenyl)-5(4H)-tetrazolinone
- 1-(2-chlorophenyl)-1,4-dihydro-5H-tetraazol-5-one
- 5H-Tetrazol-5-one, 1-(2-chlorophenyl)-1,2-dihydro-
- 5H-tetrazol-5-one, 1-(2-chlorophenyl)-1,4-dihydro-
- 1-(2-Chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fentrazamide metabolite 1
CAS:Controlled ProductFormula:C7H5ClN4OColor and Shape:White To Light YellowMolecular weight:196.59
