CymitQuimica logo

CAS 98412-23-8

:

(1-benzyl-2-sulfanyl-1H-imidazol-5-yl)methanol

Description:
(1-benzyl-2-sulfanyl-1H-imidazol-5-yl)methanol, with the CAS number 98412-23-8, is a chemical compound that features a unique structure combining an imidazole ring with a benzyl group and a sulfanyl (thiol) functional group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its possible applications in drug development. The presence of the imidazole ring suggests that it may exhibit properties similar to other imidazole derivatives, which are known for their roles in various biological processes. The sulfanyl group can contribute to the compound's reactivity and may participate in redox reactions or serve as a nucleophile. Additionally, the hydroxymethyl group enhances its solubility in polar solvents, which can be advantageous for biological interactions. Overall, this compound's structural features suggest it may have interesting pharmacological properties, warranting further investigation in the context of therapeutic applications.
Formula:C11H12N2OS
InChI:InChI=1/C11H12N2OS/c14-8-10-6-12-11(15)13(10)7-9-4-2-1-3-5-9/h1-6,14H,7-8H2,(H,12,15)
SMILES:c1ccc(cc1)Cn1c(cnc1S)CO
Synonyms:
  • 1-benzyl-5-(hydroxymethyl)-1,3-dihydro-2H-imidazole-2-thione
Found 1 products.