CymitQuimica logo

CAS 98420-98-5

:

4-Bromo-2-phenylpyridine

Description:
4-Bromo-2-phenylpyridine is an organic compound characterized by its pyridine ring substituted with a bromine atom and a phenyl group. It typically appears as a solid or liquid depending on the temperature and can be colorless to light yellow. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The phenyl group contributes to its aromatic properties, enhancing stability and influencing its solubility in organic solvents. This compound is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block in the synthesis of more complex molecules. Additionally, its unique structure allows for potential applications in materials science and as a ligand in coordination chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H8BrN
InChI:InChI=1S/C11H8BrN/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H
InChI key:HCQHVQSQHXZRGA-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC=CC(=C2)Br
Synonyms:
  • Pyridine, 4-broMo-2-phenyl-
Found 4 products.