CymitQuimica logo

CAS 98446-57-2

:

Benzenamine, 2-bromo-4-chloro-5-methoxy-

Description:
Benzenamine, 2-bromo-4-chloro-5-methoxy- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with various halogen and methoxy groups. The presence of a bromine atom at the second position and a chlorine atom at the fourth position of the benzene ring, along with a methoxy group at the fifth position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the aromatic system and the polar methoxy group. It may participate in electrophilic substitution reactions due to the electron-donating effect of the methoxy group, while the halogen substituents can influence its reactivity and stability. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H7BrClNO
InChI:InChI=1S/C7H7BrClNO/c1-11-7-3-6(10)4(8)2-5(7)9/h2-3H,10H2,1H3
InChI key:DAFZNHUYTYCENX-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C(=C1)N)Br)Cl
Found 5 products.