CAS 98447-30-4
:2-bromo-4-methoxy-1-nitrobenzene
Description:
2-Bromo-4-methoxy-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methoxy group, and a nitro group attached to a benzene ring. The presence of the bromine atom introduces electrophilic reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy group (-OCH3) is an electron-donating substituent that can influence the compound's reactivity and solubility, while the nitro group (-NO2) is an electron-withdrawing group that can enhance the compound's electrophilic character. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of functional groups allows for diverse applications in synthetic organic chemistry, including the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as both brominated and nitro compounds can pose health risks.
Formula:C7H6BrNO3
InChI:InChI=1/C7H6BrNO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3
SMILES:COc1ccc(c(c1)Br)N(=O)=O
Synonyms:- 3-Bromo-4-nitrophenyl methyl ether
- Benzene, 2-Bromo-4-Methoxy-1-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzene, 2-bromo-4-methoxy-1-nitro-
CAS:Formula:C7H6BrNO3Purity:98%Color and Shape:SolidMolecular weight:232.03142-Bromo-4-methoxy-1-nitrobenzene
CAS:2-Bromo-4-methoxy-1-nitrobenzeneFormula:C7H6BrNO3Purity:98%Molecular weight:232.0333-Bromo-4-nitroanisole
CAS:3-Bromo-4-nitroanisole is a nitroarene that reacts with biphenyls to form alkylated biphenyls. This reaction has been shown to be catalyzed by magnesium and halides, as well as organocatalytic techniques. The yield of the reaction depends on the technique used, as well as the reaction time and temperature. 3-Bromo-4-nitroanisole is a ligand that can be used in regression analysis, magnetic separation techniques, and other chemical reactions.Formula:C7H6BrNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:232.03 g/mol2-Bromo-4-methoxy-1-nitrobenzene
CAS:Formula:C7H6BrNO3Purity:95%Color and Shape:No data available.Molecular weight:232.033



