CAS 98451-51-5
:(2-amino-6-nitrophenyl)methanol
Description:
(2-amino-6-nitrophenyl)methanol is an organic compound characterized by the presence of an amino group and a nitro group attached to a phenyl ring, along with a hydroxymethyl group. Its molecular structure features a phenolic component, which contributes to its potential reactivity and solubility in polar solvents. The amino group can participate in hydrogen bonding and may influence the compound's basicity, while the nitro group is known for its electron-withdrawing properties, which can affect the compound's overall reactivity and stability. This compound may exhibit properties typical of both amines and nitro compounds, such as potential biological activity or use in synthetic organic chemistry. Its CAS number, 98451-51-5, allows for precise identification in chemical databases. As with many nitro-substituted compounds, it may also be subject to specific safety and handling considerations due to the potential for toxicity or environmental impact. Overall, (2-amino-6-nitrophenyl)methanol is a compound of interest in various chemical research and application contexts.
Formula:C7H8N2O3
InChI:InChI=1/C7H8N2O3/c8-6-2-1-3-7(9(11)12)5(6)4-10/h1-3,10H,4,8H2
SMILES:c1cc(c(CO)c(c1)N(=O)=O)N
Synonyms:- Benzenemethanol, 2-Amino-6-Nitro-
- (2-Amino-6-nitrophenyl)methanol
- 2-amino-6-nitrobenzyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(2-Amino-6-nitrophenyl)methanol
CAS:(2-Amino-6-nitrophenyl)methanolFormula:C7H8N2O3Purity:95%Molecular weight:168.152-Amino-6-nitrobenzyl alcohol
CAS:2-Amino-6-nitrobenzyl alcoholFormula:C7H8N2O3Purity:≥95%Color and Shape:SolidMolecular weight:168.150022-Amino-6-nitrobenzyl alcohol
CAS:Formula:C7H8N2O3Purity:95%Color and Shape:SolidMolecular weight:168.15002-Amino-6-nitrobenzyl alcohol
CAS:2-Amino-6-nitrobenzyl alcohol is a versatile compound that has various applications in different fields. It is commonly used as an emission source in the production of glycidyl methacrylate, an important component in adhesives and coatings. Additionally, this compound can act as a precursor for the synthesis of aldehydes, which are widely used in the pharmaceutical and fragrance industries.Formula:C7H8N2O3Purity:Min. 95%Molecular weight:168.15 g/mol




