CAS 98495-11-5
:2-(4-Ethylphenyl)-5-n-propylpyrimidine
Description:
2-(4-Ethylphenyl)-5-n-propylpyrimidine, identified by its CAS number 98495-11-5, is a chemical compound that belongs to the pyrimidine class of heterocyclic compounds. It features a pyrimidine ring substituted with an ethylphenyl group at the 2-position and a propyl group at the 5-position. This structure contributes to its unique chemical properties, including potential biological activity. Pyrimidines are known for their role in various biological processes, including nucleic acid structure and function. The presence of the ethylphenyl and propyl substituents may influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry and material science. The compound's characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Additionally, its potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with other chemical entities. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C15H18N2
InChI:InChI=1S/C15H18N2/c1-3-5-13-10-16-15(17-11-13)14-8-6-12(4-2)7-9-14/h6-11H,3-5H2,1-2H3
InChI key:BGEYOSFUJVDPRV-UHFFFAOYSA-N
SMILES:CCCC1=CN=C(N=C1)C2=CC=C(C=C2)CC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

