CymitQuimica logo

CAS 98495-35-3

:

pglu-asp-pro-phe-leu-arg-phe amide

Description:
The chemical substance known as "pglu-asp-pro-phe-leu-arg-phe amide," with the CAS number 98495-35-3, is a peptide composed of a specific sequence of amino acids. This peptide features a combination of polar and non-polar residues, which contributes to its unique properties and potential biological activities. The presence of amino acids such as glutamic acid (pglu), aspartic acid (asp), proline (pro), phenylalanine (phe), leucine (leu), arginine (arg), and another phenylalanine (phe) suggests that it may exhibit various interactions, including hydrogen bonding and hydrophobic interactions, influencing its conformation and stability. The amide group at the end of the peptide chain indicates that it may have enhanced stability compared to free amino acids. Peptides like this one can play significant roles in biological processes, including signaling and enzyme activity, and may have applications in pharmaceuticals and biotechnology. However, specific characteristics such as solubility, melting point, and biological activity would require empirical data for precise evaluation.
Formula:C44H61N11O10
InChI:InChI=1/C44H61N11O10/c1-25(2)21-31(40(62)50-28(15-9-19-48-44(46)47)38(60)51-30(37(45)59)22-26-11-5-3-6-12-26)52-41(63)32(23-27-13-7-4-8-14-27)53-42(64)34-16-10-20-55(34)43(65)33(24-36(57)58)54-39(61)29-17-18-35(56)49-29/h3-8,11-14,25,28-34H,9-10,15-24H2,1-2H3,(H2,45,59)(H,49,56)(H,50,62)(H,51,60)(H,52,63)(H,53,64)(H,54,61)(H,57,58)(H4,46,47,48)/t28-,29-,30-,31-,32-,33-,34-/m0/s1
InChI key:CLWGEQPXAKIVMA-NXBWRCJVSA-N
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccccc1)N=C([C@@H]1CCCN1C(=O)[C@H](CC(=O)O)N=C([C@@H]1CCC(=N1)O)O)O)O
Synonyms:
  • Pyr-Asp-Pro-Phe-Leu-Arg-Phe-NH2
  • 5-oxo-L-prolyl-L-alpha-aspartyl-L-prolyl-L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
  • Fmrf-Like Peptide
Found 4 products.