CAS 98495-35-3
:pglu-asp-pro-phe-leu-arg-phe amide
Description:
The chemical substance known as "pglu-asp-pro-phe-leu-arg-phe amide," with the CAS number 98495-35-3, is a peptide composed of a specific sequence of amino acids. This peptide features a combination of polar and non-polar residues, which contributes to its unique properties and potential biological activities. The presence of amino acids such as glutamic acid (pglu), aspartic acid (asp), proline (pro), phenylalanine (phe), leucine (leu), arginine (arg), and another phenylalanine (phe) suggests that it may exhibit various interactions, including hydrogen bonding and hydrophobic interactions, influencing its conformation and stability. The amide group at the end of the peptide chain indicates that it may have enhanced stability compared to free amino acids. Peptides like this one can play significant roles in biological processes, including signaling and enzyme activity, and may have applications in pharmaceuticals and biotechnology. However, specific characteristics such as solubility, melting point, and biological activity would require empirical data for precise evaluation.
Formula:C44H61N11O10
InChI:InChI=1/C44H61N11O10/c1-25(2)21-31(40(62)50-28(15-9-19-48-44(46)47)38(60)51-30(37(45)59)22-26-11-5-3-6-12-26)52-41(63)32(23-27-13-7-4-8-14-27)53-42(64)34-16-10-20-55(34)43(65)33(24-36(57)58)54-39(61)29-17-18-35(56)49-29/h3-8,11-14,25,28-34H,9-10,15-24H2,1-2H3,(H2,45,59)(H,49,56)(H,50,62)(H,51,60)(H,52,63)(H,53,64)(H,54,61)(H,57,58)(H4,46,47,48)/t28-,29-,30-,31-,32-,33-,34-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccccc1)N=C([C@@H]1CCCN1C(=O)[C@H](CC(=O)O)N=C([C@@H]1CCC(=N1)O)O)O)O
Synonyms:- Pyr-Asp-Pro-Phe-Leu-Arg-Phe-NH2
- 5-oxo-L-prolyl-L-alpha-aspartyl-L-prolyl-L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
- Fmrf-Like Peptide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phe-Met-Arg-Phe Like Peptide, Snail Helix aspersa
CAS:Phe-Met-Arg-Phe Like Peptide, Snail Helix aspersaFormula:C44H61N11O10Purity:99.70%Molecular weight:904.02Phe-Met-Arg-Phe Like Peptide, Snail Helix aspersa
CAS:FMRF is a 4-residue neuropeptide from Helix aspersa snail muscles.Formula:C44H61N11O10Purity:98%Color and Shape:SolidMolecular weight:904.02Pyr-Asp-Pro-Phe-Leu-Arg-Phe-NH2
CAS:Pyr-Asp-Pro-Phe-Leu-Arg-Phe-NH2 is a tetrapeptide that has been shown to inhibit the action of acetylcholinesterase and increase the levels of acetylcholine in the brain. Pyr-Asp-Pro-Phe-Leu-Arg-Phe-NH2 can be used as a potential drug for improving cognition and memory. It also has been found to have positive effects on blood pressure, and may be effective in treating cardiac arrhythmias. Pyr-Asp-Pro Phe Leu Arg Phe NH2 has been shown to bind to nicotinic acetylcholine receptors in ganglia, which may lead to physiological effects such as muscle contraction. The peptide is stable at neutral pH but breaks down at acidic or basic pH levels. Pyr Asp Pro Phe Leu Arg Phe NH2 can be purified by gel chromatography.Formula:C44H61N11O10Purity:Min. 95%Molecular weight:904.02 g/mol



