CAS 98510-20-4
:1,3,5-O-methylidyne-myo-inositol
Description:
1,3,5-O-Methylidyne-myo-inositol, with the CAS number 98510-20-4, is a chemical compound that belongs to the class of inositol derivatives. It is characterized by the presence of a myo-inositol backbone, which is a six-carbon cyclic sugar alcohol, modified by the addition of methylidyne groups at the 1, 3, and 5 positions. This modification can influence its solubility, reactivity, and biological activity. The compound is typically a white crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of hydroxyl groups. Its structural features may confer specific properties that could be relevant in biochemical applications, particularly in cell signaling and osmoregulation. Additionally, derivatives of inositol are often studied for their roles in cellular processes and potential therapeutic applications. However, detailed information regarding its specific biological activity, stability, and reactivity would require further investigation through experimental studies.
Formula:C7H10O6
InChI:InChI=1/C7H10O6/c8-1-4-2(9)6-3(10)5(1)12-7(11-4)13-6/h1-10H
SMILES:C1(C2C(C3C(C1OC(O2)O3)O)O)O
Synonyms:- 2,4,10-Trioxatricyclo[3.3.1.1~3,7~]Decane-6,8,9-Triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3,5-O-Methylidyne-myo-inositol
CAS:1,3,5-O-Methylidyne-myo-inositolFormula:C7H10O6Purity:98%Color and Shape:SolidMolecular weight:190.1511,3,5-O-methylidyne-myo-inositol
CAS:Formula:C7H10O6Purity:95%Color and Shape:SolidMolecular weight:190.1507myo-Inositol 1,3,5-orthoformate
CAS:myo-Inositol 1,3,5-orthoformate is a biochemical reagent that can be used as a biomaterial for life science related research and as a sulfonylation reagent for organic synthesis and drug discovery.Formula:C7H10O6Molecular weight:190.151,3,5-O-Methylidyne-myo-inositol
CAS:1,3,5-O-Methylidyne-myo-inositol is a cyclic sugar alcohol, which is naturally derived from various plant sources, including certain fruits and grains. As a stereoisomer of inositol, it represents a specific structural form that contributes to its unique properties and potential biological activities. The compound operates through modulating cellular signaling pathways, particularly those related to phosphoinositide metabolism, influencing intracellular calcium levels, and affecting lipid signaling cascades.This compound is primarily explored for its potential role in neurological health and its capacity to influence insulin signaling pathways. It has been investigated for applications in managing conditions such as polycystic ovary syndrome (PCOS), mood disorders, and neurodegenerative diseases. Due to its intricate involvement in cellular signaling networks, 1,3,5-O-Methylidyne-myo-inositol holds promise in furthering understanding of complex biological processes and for therapeutic development in metabolic and neurological disorders. Research continues to explore its efficacy and mechanisms of action to better establish its role in health and disease.Formula:C7H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:190.15 g/mol1,3,5-O-Methylidyne-myo-inositol
CAS:Controlled ProductApplications 1,3,5-O-Methylidyne-myo-inositol is a building block for the synthesis of myo-inositol phosphates.
References Lauber, M. B., Daniliuc, C.G., Paradies, J.: Chem. Comm., 49, 7409 (2013)Formula:C7H10O6Color and Shape:NeatMolecular weight:190.15






