CAS 98510-21-5
:myo-Inositol, 1,3,5-O-methylidyne-, 2,4,6-triacetate
Description:
Myo-Inositol, 1,3,5-O-methylidyne-, 2,4,6-triacetate, with the CAS number 98510-21-5, is a derivative of inositol, a carbohydrate that plays a crucial role in cellular signaling and metabolism. This compound features multiple acetyl groups, which enhance its solubility and stability compared to its parent inositol structure. It is characterized by its ability to participate in various biochemical pathways, particularly in the modulation of insulin signaling and cellular processes. The presence of the methylidyne group and triacetate moieties suggests that it may exhibit unique reactivity and biological activity, potentially influencing its pharmacological properties. Myo-inositol derivatives are often studied for their roles in neuroprotection, metabolic regulation, and as potential therapeutic agents in conditions such as polycystic ovary syndrome (PCOS) and metabolic syndrome. Its physical properties, such as melting point and solubility, can vary based on the specific formulation and purity of the compound. Overall, myo-inositol derivatives like this one are of significant interest in both research and clinical applications.
Formula:C13H16O9
InChI:InChI=1/C13H16O9/c1-4(14)17-7-10-8(18-5(2)15)12-9(19-6(3)16)11(7)21-13(20-10)22-12/h7-13H,1-3H3/t7-,8-,9-,10?,11?,12?,13?
InChI key:InChIKey=FEJXOXKCXLEXFK-VNOUZBAXNA-N
SMILES:O(C(C)=O)[C@H]1C2[C@@H](OC(C)=O)C3[C@H](OC(C)=O)C1OC(O2)O3
Synonyms:- myo-Inositol, 1,3,5-O-methylidyne-, triacetate
- myo-Inositol, 1,3,5-O-methylidyne-, 2,4,6-triacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol
CAS:2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositolFormula:C13H16O9Color and Shape:SolidMolecular weight:316.262


