CymitQuimica logo

CAS 98516-74-6

:

H-Ile-AMC

Description:
H-Ile-AMC, or N-α-(2-Amino-4-methylpentanoyl)-L-isoleucine amide, is a synthetic compound often used in biochemical research, particularly in studies involving proteolytic enzymes. This substance is characterized by its structure, which includes an isoleucine residue linked to an amide group, contributing to its stability and solubility in aqueous solutions. H-Ile-AMC is commonly utilized as a substrate in enzyme assays, where it can be cleaved by specific proteases, releasing a fluorescent or chromogenic product that can be quantitatively measured. This property makes it valuable for monitoring enzyme activity in various biological processes. Additionally, the compound's stability under physiological conditions allows for reliable experimental results. As with many synthetic peptides, its purity and concentration are crucial for experimental reproducibility, and it is typically handled under controlled laboratory conditions to maintain its integrity. Overall, H-Ile-AMC serves as an important tool in the field of biochemistry for studying enzyme kinetics and protein interactions.
Formula:C16H20N2O3
InChI:InChI=1S/C16H20N2O3/c1-4-9(2)15(17)16(20)18-11-5-6-12-10(3)7-14(19)21-13(12)8-11/h5-9,15H,4,17H2,1-3H3,(H,18,20)/t9-,15-/m0/s1
InChI key:MLILEIUKVIPULY-VFZGTOFNSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C)N
Found 3 products.