CymitQuimica logo

CAS 98519-65-4

:

4-bromo-7-chloroquinoline

Description:
4-Bromo-7-chloroquinoline is a heterocyclic organic compound that belongs to the quinoline family, characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features a bromine atom at the 4-position and a chlorine atom at the 7-position of the quinoline ring, which contributes to its unique chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents can influence its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. 4-Bromo-7-chloroquinoline may also exhibit antimicrobial or antimalarial properties, similar to other quinoline derivatives. Its synthesis often involves halogenation reactions and can be achieved through various methods, including electrophilic aromatic substitution. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C9H5BrClN
InChI:InChI=1/C9H5BrClN/c10-8-3-4-12-9-5-6(11)1-2-7(8)9/h1-5H
InChI key:IVPHNMMNLBTDRQ-UHFFFAOYSA-N
SMILES:C1=Cc2c(ccnc2C=C1Cl)Br
Synonyms:
  • Quinoline, 4-Bromo-7-Chloro-
  • T66 Bnj Ee Ig
  • 4-Bromo-7-chloroquinoline
Found 4 products.