CymitQuimica logo

CAS 98534-82-8

:

1-(3-chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Description:
1-(3-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chlorophenyl group at the 1-position and a trifluoromethyl group at the 5-position, contributing to its unique chemical properties. The presence of the carboxylic acid functional group at the 4-position enhances its acidity and reactivity, making it useful in various chemical reactions. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's biological activity. This substance may exhibit potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its structural characteristics. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its solubility and stability in different environments. Overall, this compound's unique functional groups and structural features make it of interest in both research and industrial applications.
Formula:C11H6ClF3N2O2
InChI:InChI=1/C11H6ClF3N2O2/c12-6-2-1-3-7(4-6)17-9(11(13,14)15)8(5-16-17)10(18)19/h1-5H,(H,18,19)
InChI key:FIZDWSPZPPDMBZ-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)n1c(c(cn1)C(=O)O)C(F)(F)F)Cl
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 1-(3-chlorophenyl)-5-(trifluoromethyl)-
  • 1-(3-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Found 2 products.