CAS 98545-64-3

methyl 4-amino-2-bromobenzoate

Description:

Methyl 4-amino-2-bromobenzoate, with the CAS number 98545-64-3, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which is further substituted with an amino group and a bromine atom. This compound typically appears as a solid or crystalline substance and is characterized by its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The bromine atom serves as a useful site for further functionalization, making it a valuable intermediate in organic synthesis. Methyl 4-amino-2-bromobenzoate may also exhibit biological activity, which can be explored in pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₈BrNO₂

InChI: InChI=1/C8H8BrNO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,10H2,1H3

InChI key: KZOQVTUWEHNNMH-UHFFFAOYSA-N

SMILES: COC(=O)c1ccc(cc1Br)N

Methyl 4-amino-2-bromobenzoate

CAS: 98545-64-3

Methyl 4-amino-2-bromobenzoate

Formula: C₈H₈BrNO₂

Purity: 98%

Molecular weight: 230.061

Ref: 54-OR75094

Methyl 4-amino-2-bromobenzoate

CAS: 98545-64-3

Formula: C₈H₈BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 230.0586

Ref: IN-DA00IK4D

Methyl 4-amino-2-bromobenzoate

CAS: 98545-64-3

Methyl 4-amino-2-bromobenzoate

Formula: C₈H₈BrNO₂

Purity: 95%

Molecular weight: 230.06

Ref: IN-DG246332

Methyl 4-amino-2-bromobenzoate

CAS: 98545-64-3

Formula: C₈H₈BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 230.061

Ref: 10-F319485