CymitQuimica logo

CAS 98550-01-7

:

1H-Indazole-5-sulfonic acid

Description:
1H-Indazole-5-sulfonic acid is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The sulfonic acid group (-SO3H) is attached to the indazole at the 5-position, imparting acidic properties to the molecule. This compound is typically a white to off-white solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. It is often used in biochemical applications, particularly in the synthesis of various pharmaceuticals and as a reagent in organic chemistry. The sulfonic acid functionality makes it a strong acid, and it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 1H-Indazole-5-sulfonic acid may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 98550-01-7, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C7H6N2O3S
InChI:InChI=1S/C7H6N2O3S/c10-13(11,12)6-1-2-7-5(3-6)4-8-9-7/h1-4H,(H,8,9)(H,10,11,12)
InChI key:MXWSQZWVKUTEEI-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1S(=O)(=O)O)C=NN2
Found 2 products.