CymitQuimica logo

CAS 98556-09-3

:

N-(2-broMo-5-nitrophenyl)forMaMide

Description:
N-(2-Bromo-5-nitrophenyl)formamide, with the CAS number 98556-09-3, is an organic compound characterized by the presence of a formamide functional group attached to a phenyl ring that is substituted with both bromine and nitro groups. The bromine atom is located at the 2-position, while the nitro group is at the 5-position of the phenyl ring, contributing to the compound's reactivity and potential applications in organic synthesis. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and materials science. The presence of both electron-withdrawing groups (bromo and nitro) can influence its electronic properties, potentially enhancing its reactivity. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and nitro groups, which can be hazardous.
Formula:C7H5BrN2O3
InChI:InChI=1S/C7H5BrN2O3/c8-6-2-1-5(10(12)13)3-7(6)9-4-11/h1-4H,(H,9,11)
InChI key:ATYLSWFOQJOHCN-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])NC=O)Br
Synonyms:
  • N-(2-broMo-5-nitrophenyl)forMaMide
Found 1 products.