CymitQuimica logo

CAS 98591-60-7

:

5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride

Description:
5-Phenyl-1,3,4-oxadiazole-2-carbonyl chloride is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group attached to the oxadiazole, contributing to its aromatic properties. The presence of a carbonyl chloride functional group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of amides and esters. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity is influenced by the electron-withdrawing nature of the carbonyl and the halogen, which can facilitate nucleophilic attack. Additionally, 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride may have applications in medicinal chemistry and materials science due to its potential to form diverse derivatives. As with many chemical substances, proper handling and safety precautions are essential, given its reactive nature.
Formula:C9H5ClN2O2
InChI:InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H
SMILES:c1ccc(cc1)c1nnc(C(=O)Cl)o1
Found 1 products.