CymitQuimica logo

CAS 98626-92-7

:

2-bromo-6-(methylsulfonyl)pyridine

Description:
2-Bromo-6-(methylsulfonyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a methylsulfonyl group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the sulfonyl group, which enhances its reactivity and polarity. The bromine substituent can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the methylsulfonyl group can serve as a leaving group or participate in various chemical transformations. 2-Bromo-6-(methylsulfonyl)pyridine is often utilized in medicinal chemistry and material science for the development of pharmaceuticals and agrochemicals. Its specific reactivity and functional group characteristics make it a valuable compound in synthetic organic chemistry.
Formula:C6H6BrNO2S
InChI:InChI=1S/C6H6BrNO2S/c1-11(9,10)6-4-2-3-5(7)8-6/h2-4H,1H3
InChI key:DOSBGYNVIALPBI-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1=NC(=CC=C1)Br
Found 4 products.