CAS 98632-99-6

Formula: C6H11NO4

InChI: InChI=1S/C6H11NO4/c1-4(8)7-5(3-11-2)6(9)10/h5H,3H2,1-2H3,(H,7,8)(H,9,10)

InChI key: SDNGNSKFWTZCJG-UHFFFAOYSA-N

SMILES: CC(=O)NC(COC)C(=O)O

2-Acetamido-3-methoxypropanoic acid

CAS: 98632-99-6

2-Acetamido-3-methoxypropanoic acid

Formula: C₆H₁₁NO₄

Purity: 97%

Molecular weight: 161.16

Ref: 54-OR1058652

2-Acetamido-3-methoxypropanoic acid

CAS: 98632-99-6

2-Acetamido-3-methoxypropanoic acid

Formula: C₆H₁₁NO₄

Purity: 97%

Molecular weight: 161.16

Ref: IN-DG142959

2-acetamido-3-methoxypropanoic acid

CAS: 98632-99-6

2-acetamido-3-methoxypropanoic acid is a versatile compound with various characteristics and applications. It is commonly known as desthiobiotin and is a hydrogen atom donor, which makes it an essential component in many biological processes. This compound acts as a growth factor, promoting cell proliferation and development.

Formula: C₆H₁₁NO₄

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-YDA63299

Lacosamide Impurity 8

CAS: 98632-99-6

Formula: C₆H₁₁NO₄

Molecular weight: 161.16

Ref: ST-EA-CP-L8030