CymitQuimica logo

CAS 98642-44-5

:

Carbamic acid, (3-hydroxypropyl)methyl-, 1,1-dimethylethyl ester

Description:
Carbamic acid, (3-hydroxypropyl)methyl-, 1,1-dimethylethyl ester, identified by CAS number 98642-44-5, is an organic compound characterized by its carbamate functional group. This substance typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and may have limited solubility in water, depending on the specific structure and substituents. The presence of the hydroxypropyl group suggests potential for hydrogen bonding, which can influence its physical properties and reactivity. This compound may be used in various applications, including as an intermediate in organic synthesis or in the formulation of agrochemicals. Safety data should be consulted to understand its toxicity, handling precautions, and environmental impact, as with any chemical substance. Overall, its unique structure contributes to its specific chemical behavior and potential utility in industrial applications.
Formula:C9H19NO3
InChI:InChI=1S/C9H19NO3/c1-9(2,3)13-8(12)10(4)6-5-7-11/h11H,5-7H2,1-4H3
InChI key:GJGLBUZZTLPCOT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(C)CCCO
Synonyms:
  • tert-butyl 3-hydroxypropylmethylcarbamate
Found 6 products.