CAS 98648-34-1
:1-Hexadecanamine,N-methyl-N-nitroso-
Description:
1-Hexadecanamine, N-methyl-N-nitroso- is an organic compound characterized by its long hydrocarbon chain and the presence of both amine and nitroso functional groups. As a derivative of hexadecanamine, it features a 16-carbon straight-chain alkyl group, which contributes to its hydrophobic properties. The N-methyl group indicates that one of the hydrogen atoms on the nitrogen atom of the amine has been replaced by a methyl group, enhancing its steric properties. The nitroso group (-N=O) introduces potential reactivity, particularly in the context of nitrosation reactions, which can lead to the formation of nitrosamines, compounds of interest due to their potential carcinogenic properties. This compound is likely to be a solid at room temperature due to its long carbon chain, and it may exhibit surfactant-like behavior, making it relevant in various chemical applications. Safety and handling precautions are essential due to the potential toxicity associated with nitroso compounds.
Formula:C17H36N2O
InChI:InChI=1S/C17H36N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(2)18-20/h3-17H2,1-2H3
InChI key:CRWBBWJOAPFABB-UHFFFAOYSA-N
SMILES:CCCCCCCCCCCCCCCCN(C)N=O
Synonyms:- N-Nitroso-N-Methylhexadecylamine
- N-Methyl-N-Nitroso Hexadecylamine
- N-hexadecyl-N-methylnitrous amide
- N-Methyl-N-nitroso-1-hexadecanamine
- N-Methyl-N-nitroso-1-hexadecylamine
- CRWBBWJOAPFABB-UHFFFAOYSA-N
- 1-Hexadecanamine, N-methyl-N-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-Methyl-N-nitroso-1-hexadecylamine
CAS:Applications N-Methyl-N-nitroso-1-hexadecanamine is a compound found in a wide range of cosmetic products and cleaning emulsions.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Kamp, E.. et al.: Food. Chem. Toxicol., 29, 203 (1991); Lalljie, S. P. D., et al.: Adv. Mass. Spec., 14, 33790 (1998); Abidi, S.L., et al.: J. Chroma., 324, 209 (1985);Formula:C17H36N2OColor and Shape:NeatMolecular weight:284.48


